CAS 131844-46-7 appears in our catalog under these names: rac-(1r,2s)-2-(3-chlorophenyl)cyclopropan-1-amine hydrochloride, 95%, trans-2-(3-Chlorophenyl)cyclopropanamine Hydrochloride, trans-2-(3-Chlorophenyl)cyclopropanamine Hydrochloride, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
Trans-(1R,2S)-2-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride (CAS 131844-46-7) is a chemical compound with the molecular formula C9H11Cl2N and a molecular weight of 204.09 g/mol. IUPAC name: trans-(1R,2S)-2-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: QRDJNIKTHWYMIN-OULXEKPRSA-N.
| Molecular formula | C9H11Cl2N |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | trans-(1R,2S)-2-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | QRDJNIKTHWYMIN-OULXEKPRSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)