cas: 26568-26-3 — see every product listed under this CAS number, including other names
trans-2-(4-Fluorophenyl)cyclopropanamine hydrochloride 95% (CAS 26568-26-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A719446-100mg |
| cas | 26568-26-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 476.06 Pln | |
| Ambeed | 250mg | 804.25 Pln | |
| Ambeed | 1g | 2000.19 Pln | |
| Ambeed | 5g | 6461.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A719446 |
Trans-(1R,2S)-2-(4-fluorophenyl)cyclopropan-1-amine;hydrochloride (CAS 26568-26-3) is a chemical compound with the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. IUPAC name: trans-(1R,2S)-2-(4-fluorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: ZQPBZLHQLCAFOQ-OULXEKPRSA-N.
| Molecular formula | C9H11ClFN |
|---|---|
| Molecular weight | 187.64 g/mol |
| IUPAC name | trans-(1R,2S)-2-(4-fluorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | ZQPBZLHQLCAFOQ-OULXEKPRSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)