cas: 40248-63-3 — see every product listed under this CAS number, including other names
(-)-Menthyloxyacetic acid 98% (CAS 40248-63-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A339040-250mg |
| cas | 40248-63-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 375.94 Pln | |
| Ambeed | 10g | 576.19 Pln | |
| Ambeed | 25g | 1338.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A339040 |
2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetic acid (CAS 40248-63-3) is a chemical compound with the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. IUPAC name: 2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetic acid. InChIKey: CILPHQCEVYJUDN-UHFFFAOYSA-N.
| Molecular formula | C12H22O3 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | 2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetic acid |
| InChIKey | CILPHQCEVYJUDN-UHFFFAOYSA-N |
| SMILES | CC1CCC(C(C1)OCC(=O)O)C(C)C |
Computed by PubChem (NCBI)