cas: 5122-94-1 — see every product listed under this CAS number, including other names
(1,1'-Biphenyl-4-yl)boronic acid, 98%, 98% (CAS 5122-94-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 250g, 500g, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148CN-5g |
| cas | 5122-94-1 |
| size | 5g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 102.80 Pln | |
| Chemat | 100g | 213.20 Pln | |
| Chemat | 250g | 438.80 Pln | |
| Chemat | 500g | 888.00 Pln | |
| Chemat | 5kg | 6278.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-phenylphenyl)boronic acid (CAS 5122-94-1) is a chemical compound with the molecular formula C12H11BO2 and a molecular weight of 198.03 g/mol. IUPAC name: (4-phenylphenyl)boronic acid. InChIKey: XPEIJWZLPWNNOK-UHFFFAOYSA-N.
| Molecular formula | C12H11BO2 |
|---|---|
| Molecular weight | 198.03 g/mol |
| IUPAC name | (4-phenylphenyl)boronic acid |
| InChIKey | XPEIJWZLPWNNOK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)