[1,1'-Biphenyl]-4-ylboronic acid, 99.99%
cas: 5122-94-1 — see every product listed under this CAS number, including other names
[1,1'-Biphenyl]-4-ylboronic acid, 99.99% (CAS 5122-94-1) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 500 g, 1 kg, 25 g, 5 g, 50 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W002364-100 g |
| cas | 5122-94-1 |
| size | 100 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 928.06 Pln | |
| MedChemExpress | 500 g | 1731.47 Pln | |
| MedChemExpress | 1 kg | 2711.35 Pln | |
| MedChemExpress | 25 g | 431.15 Pln | |
| MedChemExpress | 5 g | 240.74 Pln | |
| MedChemExpress | 50 g | 621.55 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.99% |
(4-phenylphenyl)boronic acid (CAS 5122-94-1) is a chemical compound with the molecular formula C12H11BO2 and a molecular weight of 198.03 g/mol. IUPAC name: (4-phenylphenyl)boronic acid. InChIKey: XPEIJWZLPWNNOK-UHFFFAOYSA-N.
| Molecular formula | C12H11BO2 |
|---|---|
| Molecular weight | 198.03 g/mol |
| IUPAC name | (4-phenylphenyl)boronic acid |
| InChIKey | XPEIJWZLPWNNOK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)