cas: 5122-94-1 — see every product listed under this CAS number, including other names
4-Biphenylboronic acid, 97% (CAS 5122-94-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 394420010 |
| cas | 5122-94-1 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 156.35 Pln | |
| Thermo Scientific (Acros) | 5g | 353.24 Pln | |
| Thermo Scientific (Acros) | 25g | 1037.89 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
(4-phenylphenyl)boronic acid (CAS 5122-94-1) is a chemical compound with the molecular formula C12H11BO2 and a molecular weight of 198.03 g/mol. IUPAC name: (4-phenylphenyl)boronic acid. InChIKey: XPEIJWZLPWNNOK-UHFFFAOYSA-N.
| Molecular formula | C12H11BO2 |
|---|---|
| Molecular weight | 198.03 g/mol |
| IUPAC name | (4-phenylphenyl)boronic acid |
| InChIKey | XPEIJWZLPWNNOK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)