cas: 5122-94-1 — see every product listed under this CAS number, including other names
4-Biphenylboronic Acid (contains varying amounts of Anhydride) (CAS 5122-94-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B2294-5G |
| cas | 5122-94-1 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 103.59 Pln | |
| TCI | 25g | 280.61 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | 0 |
(4-phenylphenyl)boronic acid (CAS 5122-94-1) is a chemical compound with the molecular formula C12H11BO2 and a molecular weight of 198.03 g/mol. IUPAC name: (4-phenylphenyl)boronic acid. InChIKey: XPEIJWZLPWNNOK-UHFFFAOYSA-N.
| Molecular formula | C12H11BO2 |
|---|---|
| Molecular weight | 198.03 g/mol |
| IUPAC name | (4-phenylphenyl)boronic acid |
| InChIKey | XPEIJWZLPWNNOK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)