[1,1'-Biphenyl]-4-ylboronic acid, 98%
cas: 5122-94-1 — see every product listed under this CAS number, including other names
[1,1'-Biphenyl]-4-ylboronic acid, 98% (CAS 5122-94-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A105961-5g |
| cas | 5122-94-1 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 125.62 Pln | |
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 209.06 Pln | |
| Ambeed | 100g | 325.88 Pln | |
| Ambeed | 500g | 1316.00 Pln | |
| BLDpharm | 5g | 186.63 Pln | |
| BLDpharm | 10g | 203.29 Pln | |
| BLDpharm | 25g | 219.95 Pln | |
| BLDpharm | 100g | 331.02 Pln | |
| BLDpharm | 500g | 1375.10 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(4-phenylphenyl)boronic acid (CAS 5122-94-1) is a chemical compound with the molecular formula C12H11BO2 and a molecular weight of 198.03 g/mol. IUPAC name: (4-phenylphenyl)boronic acid. InChIKey: XPEIJWZLPWNNOK-UHFFFAOYSA-N.
| Molecular formula | C12H11BO2 |
|---|---|
| Molecular weight | 198.03 g/mol |
| IUPAC name | (4-phenylphenyl)boronic acid |
| InChIKey | XPEIJWZLPWNNOK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)