cas: 502498-89-7 — see every product listed under this CAS number, including other names
(1-(Methoxyimino)-2,3-dihydro-1H-inden-5-yl)boronic acid, 95%, 95% (CAS 502498-89-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FKZL-250mg |
| cas | 502498-89-7 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1302.80 Pln | |
| Chemat | 1g | 2819.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[(1E)-1-methoxyimino-2,3-dihydroinden-5-yl]boronic acid (CAS 502498-89-7) is a chemical compound with the molecular formula C10H12BNO3 and a molecular weight of 205.02 g/mol. IUPAC name: [(1E)-1-methoxyimino-2,3-dihydroinden-5-yl]boronic acid. InChIKey: UVWBADYWXYEXEE-ZRDIBKRKSA-N.
| Molecular formula | C10H12BNO3 |
|---|---|
| Molecular weight | 205.02 g/mol |
| IUPAC name | [(1E)-1-methoxyimino-2,3-dihydroinden-5-yl]boronic acid |
| InChIKey | UVWBADYWXYEXEE-ZRDIBKRKSA-N |
| SMILES | B(C1=CC2=C(C=C1)/C(=N/OC)/CC2)(O)O |
Computed by PubChem (NCBI)