CAS 515140-26-8 appears in our catalog under these names: 4-(Cyclopropylaminocarbonyl)phenylboronic acid, 98%, 4–(Cyclopropylaminocarbonyl)phenylboronic acid, (4-((Cyclopropylmethyl)carbamoyl)phenyl)boronic acid 98%, (4-((Cyclopropylmethyl)carbamoyl)phenyl)boronic acid, 98%, 98%, (4-((Cyclopropylmethyl)carbamoyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 100mg, 250mg.
[4-(cyclopropylcarbamoyl)phenyl]boronic acid (CAS 515140-26-8) is a chemical compound with the molecular formula C10H12BNO3 and a molecular weight of 205.02 g/mol. IUPAC name: [4-(cyclopropylcarbamoyl)phenyl]boronic acid. InChIKey: WCRPDYXXIVYAAJ-UHFFFAOYSA-N.
| Molecular formula | C10H12BNO3 |
|---|---|
| Molecular weight | 205.02 g/mol |
| IUPAC name | [4-(cyclopropylcarbamoyl)phenyl]boronic acid |
| InChIKey | WCRPDYXXIVYAAJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC2CC2)(O)O |
Computed by PubChem (NCBI)