CAS 850567-23-6 appears in our catalog under these names: 3-(Cyclopropylaminocarbonyl)phenylboronic acid, 97%, 3-(Cyclopropylcarbamoyl)phenylboronic Acid (>90%), >95% (HPLC), (3-(Cyclopropylcarbamoyl)phenyl)boronic acid, 98%, (3-(Cyclopropylcarbamoyl)phenyl)boronic acid 98%, (3-(Cyclopropylcarbamoyl)phenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, TRC, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 100mg, 25mg, 50mg, 250mg.
[3-(cyclopropylcarbamoyl)phenyl]boronic acid (CAS 850567-23-6) is a chemical compound with the molecular formula C10H12BNO3 and a molecular weight of 205.02 g/mol. IUPAC name: [3-(cyclopropylcarbamoyl)phenyl]boronic acid. InChIKey: ACYLEYDBPWXTIO-UHFFFAOYSA-N.
| Molecular formula | C10H12BNO3 |
|---|---|
| Molecular weight | 205.02 g/mol |
| IUPAC name | [3-(cyclopropylcarbamoyl)phenyl]boronic acid |
| InChIKey | ACYLEYDBPWXTIO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC2CC2)(O)O |
Computed by PubChem (NCBI)