CAS 850568-68-2 is the registry number for 2-(4-Boronophenyl)-5,6-dihydro-4H-1,3-oxazine, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[4-(5,6-dihydro-4H-1,3-oxazin-2-yl)phenyl]boronic acid (CAS 850568-68-2) is a chemical compound with the molecular formula C10H12BNO3 and a molecular weight of 205.02 g/mol. IUPAC name: [4-(5,6-dihydro-4H-1,3-oxazin-2-yl)phenyl]boronic acid. InChIKey: OASSAUSIPZASKK-UHFFFAOYSA-N.
| Molecular formula | C10H12BNO3 |
|---|---|
| Molecular weight | 205.02 g/mol |
| IUPAC name | [4-(5,6-dihydro-4H-1,3-oxazin-2-yl)phenyl]boronic acid |
| InChIKey | OASSAUSIPZASKK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=NCCCO2)(O)O |
Computed by PubChem (NCBI)