Products 2096339-85-2
CAS 2096339-85-2 is the registry number for 4-Cyano-3-isopropoxyphenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(4-cyano-3-propan-2-yloxyphenyl)boronic acid (CAS 2096339-85-2) is a chemical compound with the molecular formula C10H12BNO3 and a molecular weight of 205.02 g/mol. IUPAC name: (4-cyano-3-propan-2-yloxyphenyl)boronic acid. InChIKey: XRTVNVUITJLVSU-UHFFFAOYSA-N.
| Molecular formula | C10H12BNO3 |
|---|---|
| Molecular weight | 205.02 g/mol |
| IUPAC name | (4-cyano-3-propan-2-yloxyphenyl)boronic acid |
| InChIKey | XRTVNVUITJLVSU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C#N)OC(C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Cyano-3-isopropoxyphenylboronic acid, (4-cyano-3-propan-2-yloxyphenyl)boronic acid, (4-Cyano-3-isopropoxyphenyl)boronic acid, (4-Cyano-3-isopropoxyphenyl)boronicacid, (4-cyano-3-isopropoxy-phenyl)boronic acid, {4-Cyano-3-[(propan-2-yl)oxy]phenyl}boronic acid, 4-Cyano-3-isopropoxyphenylboronic acid, AldrichCPR, Boronic acid, B-[4-cyano-3-(1-methylethoxy)phenyl]-