Products 279262-22-5
CAS 279262-22-5 appears in our catalog under these names: 3-Cyano-4-propoxyphenylboronic acid, 98%, (3-Cyano-4-propoxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 25g.
(3-cyano-4-propoxyphenyl)boronic acid (CAS 279262-22-5) is a chemical compound with the molecular formula C10H12BNO3 and a molecular weight of 205.02 g/mol. IUPAC name: (3-cyano-4-propoxyphenyl)boronic acid. InChIKey: WJKHGXOUYOBGPF-UHFFFAOYSA-N.
| Molecular formula | C10H12BNO3 |
|---|---|
| Molecular weight | 205.02 g/mol |
| IUPAC name | (3-cyano-4-propoxyphenyl)boronic acid |
| InChIKey | WJKHGXOUYOBGPF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCCC)C#N)(O)O |
Computed by PubChem (NCBI)