CAS 1548739-47-4 is the registry number for (1-Acetylindolin-4-yl)boronic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1-acetyl-2,3-dihydroindol-4-yl)boronic acid (CAS 1548739-47-4) is a chemical compound with the molecular formula C10H12BNO3 and a molecular weight of 205.02 g/mol. IUPAC name: (1-acetyl-2,3-dihydroindol-4-yl)boronic acid. InChIKey: ORRLJEBPIOIIJM-UHFFFAOYSA-N.
| Molecular formula | C10H12BNO3 |
|---|---|
| Molecular weight | 205.02 g/mol |
| IUPAC name | (1-acetyl-2,3-dihydroindol-4-yl)boronic acid |
| InChIKey | ORRLJEBPIOIIJM-UHFFFAOYSA-N |
| SMILES | B(C1=C2CCN(C2=CC=C1)C(=O)C)(O)O |
Computed by PubChem (NCBI)