cas: 389057-34-5 — see every product listed under this CAS number, including other names
(1R,2R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)cyclohexanecarboxylic acid, 97%, 97% (CAS 389057-34-5) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BYZH-500mg |
| cas | 389057-34-5 |
| size | 500mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 587.60 Pln | |
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 1000.40 Pln | |
| Chemat | 5g | 3813.20 Pln | |
| Chemat | 10g | 7091.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Trans-(1R,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 389057-34-5) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: trans-(1R,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: NZMNDTGOODAUNI-UYAOXDASSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | trans-(1R,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | NZMNDTGOODAUNI-UYAOXDASSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)