cas: 389057-34-5 — see every product listed under this CAS number, including other names
Fmoc-(1R,2R-ACHC-OH 95% (CAS 389057-34-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A171585-25g |
| cas | 389057-34-5 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 19900.31 Pln | |
| Ambeed | 100mg | 320.31 Pln | |
| Ambeed | 250mg | 581.75 Pln | |
| Ambeed | 1g | 1527.38 Pln | |
| Ambeed | 5g | 5899.50 Pln | |
| Ambeed | 10g | 9982.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A171585 |
Trans-(1R,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 389057-34-5) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: trans-(1R,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: NZMNDTGOODAUNI-UYAOXDASSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | trans-(1R,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | NZMNDTGOODAUNI-UYAOXDASSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)