cas: 222530-45-2 — see every product listed under this CAS number, including other names
(1R,3R)-Methyl 3-aminocyclopentanecarboxylate hydrochloride, 97% (CAS 222530-45-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F552178-250MG |
| cas | 222530-45-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 487.35 Pln | |
| Fluorochem | 500mg | 846.59 Pln | |
| Fluorochem | 1g | 1570.30 Pln | |
| Fluorochem | 5g | 5162.78 Pln | |
| Fluorochem | 10g | 8567.83 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Trans-methyl (1R,3R)-3-aminocyclopentane-1-carboxylate;hydrochloride (CAS 222530-45-2) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: trans-methyl (1R,3R)-3-aminocyclopentane-1-carboxylate;hydrochloride. InChIKey: CKMCJNXERREXFB-KGZKBUQUSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | trans-methyl (1R,3R)-3-aminocyclopentane-1-carboxylate;hydrochloride |
| InChIKey | CKMCJNXERREXFB-KGZKBUQUSA-N |
| SMILES | COC(=O)[C@@H]1CC[C@H](C1)N.Cl |
Computed by PubChem (NCBI)