cas: 222530-45-2 — see every product listed under this CAS number, including other names
Methyl trans-3-aminocyclopentanecarboxylate Hydrochlorid, 97%, 97% (CAS 222530-45-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114ADL-100mg |
| cas | 222530-45-2 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 1g | 1197.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Trans-methyl (1R,3R)-3-aminocyclopentane-1-carboxylate;hydrochloride (CAS 222530-45-2) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: trans-methyl (1R,3R)-3-aminocyclopentane-1-carboxylate;hydrochloride. InChIKey: CKMCJNXERREXFB-KGZKBUQUSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | trans-methyl (1R,3R)-3-aminocyclopentane-1-carboxylate;hydrochloride |
| InChIKey | CKMCJNXERREXFB-KGZKBUQUSA-N |
| SMILES | COC(=O)[C@@H]1CC[C@H](C1)N.Cl |
Computed by PubChem (NCBI)