cas: 1426827-79-3 — see every product listed under this CAS number, including other names
(1R,8S,9s)–Bicyclo(6·1·0)non–4–yn–9–ylmethyl (2,5–dioxopyrrolidin–1–yl) carbonate (CAS 1426827-79-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 50mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB50140-100 |
| cas | 1426827-79-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 1785.89 Pln | |
| GLPBio | 1g | 4626.95 Pln | |
| GLPBio | 250mg | 2698.58 Pln | |
| GLPBio | 50mg | 1294.43 Pln | |
| GLPBio | 5g | 13051.85 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
[(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate (CAS 1426827-79-3) is a chemical compound with the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. IUPAC name: [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate. InChIKey: SKTDJYHCSCYLQU-FOSCPWQOSA-N.
| Molecular formula | C15H17NO5 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| InChIKey | SKTDJYHCSCYLQU-FOSCPWQOSA-N |
| SMILES | C1C[C@@H]2[C@@H](C2COC(=O)ON3C(=O)CCC3=O)CCC#C1 |
Computed by PubChem (NCBI)