cas: 1426827-79-3 — see every product listed under this CAS number, including other names
(1R,8S,9s)-Bicyclo[6.1.0]non-4-yn-9-ylmethyl Succinimidyl Carbonate, >90.0%(qNMR) (CAS 1426827-79-3) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B6275-10MG |
| cas | 1426827-79-3 |
| size | 10mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 10mg | 601.73 Pln | |
| TCI | 100mg | 2745.65 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >90.0%(qNMR) |
[(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate (CAS 1426827-79-3) is a chemical compound with the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. IUPAC name: [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate. InChIKey: SKTDJYHCSCYLQU-FOSCPWQOSA-N.
| Molecular formula | C15H17NO5 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| InChIKey | SKTDJYHCSCYLQU-FOSCPWQOSA-N |
| SMILES | C1C[C@@H]2[C@@H](C2COC(=O)ON3C(=O)CCC3=O)CCC#C1 |
Computed by PubChem (NCBI)