cas: 1426827-79-3 — see every product listed under this CAS number, including other names
(1R,8S,9s)-Bicyclo[6.1.0]non-4-yn-9-ylmethyl Succinimidyl Carbonate, 98%, 98% (CAS 1426827-79-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FNCY-50mg |
| cas | 1426827-79-3 |
| size | 50mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 165.20 Pln | |
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 1g | 890.00 Pln | |
| Chemat | 5g | 2958.80 Pln | |
| Chemat | 10g | 5435.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate (CAS 1426827-79-3) is a chemical compound with the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. IUPAC name: [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate. InChIKey: SKTDJYHCSCYLQU-FOSCPWQOSA-N.
| Molecular formula | C15H17NO5 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| InChIKey | SKTDJYHCSCYLQU-FOSCPWQOSA-N |
| SMILES | C1C[C@@H]2[C@@H](C2COC(=O)ON3C(=O)CCC3=O)CCC#C1 |
Computed by PubChem (NCBI)