cas: 245115-25-7 — see every product listed under this CAS number, including other names
(1R,2R)–2–((tert–Butoxycarbonyl)amino)cyclopentanecarboxylic acid (CAS 245115-25-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF53977-100mg |
| cas | 245115-25-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 540.87 Pln | |
| GLPBio | 1g | 1037.01 Pln | |
| GLPBio | 250mg | 643.84 Pln | |
| GLPBio | 5g | 3250.88 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid (CAS 245115-25-7) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid. InChIKey: BUEPEVBYNBQNED-HTQZYQBOSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid |
| InChIKey | BUEPEVBYNBQNED-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)