CAS 136315-70-3 appears in our catalog under these names: Boc-NH-cis-cyclopentane-COOH, cis-2-(tert-Butoxycarbonylamino)-1-cyclopentanecarboxylic acid, 98%, cis-2-Bocamino-cyclopentanecarboxylic acid, 98%, Boc-cis-Acpc, 98%. Offered by: Iris Biotech, Thermo Scientific (Acros), Fluorochem, Ambeed. Available pack sizes: 1g, 250MG, 5g.
Cis-(1R,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid (CAS 136315-70-3) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: cis-(1R,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid. InChIKey: BUEPEVBYNBQNED-SFYZADRCSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | cis-(1R,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid |
| InChIKey | BUEPEVBYNBQNED-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)