CAS 136315-71-4 appears in our catalog under these names: trans–2–((tert–Butoxycarbonyl)amino)cyclopentanecarboxylic acid, trans-2-((tert-Butoxycarbonyl)amino)cyclopentanecarboxylic acid, 95%, 95%, trans-2-((tert-Butoxycarbonyl)amino)cyclopentanecarboxylic acid, 95%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid (CAS 136315-71-4) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid. InChIKey: BUEPEVBYNBQNED-HTQZYQBOSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid |
| InChIKey | BUEPEVBYNBQNED-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)