CAS 143679-80-5 appears in our catalog under these names: (1S,2S)–2–((tert–Butoxycarbonyl)amino)cyclopentanecarboxylic acid, Boc-ACPC-OH (1S,2S), (1S,2S)-Boc-aminocyclopentane carboxylic acid, (1S,2S)-2-(Boc-amino)cyclopentanecarboxylicacid 95%, (1S,2S)-Boc-aminocyclopentanecarboxylic acid, 98%, 98%. Offered by: GLPBio, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 500mg, 1000mg, 2000mg, 25g.
Trans-(1S,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid (CAS 143679-80-5) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: trans-(1S,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid. InChIKey: BUEPEVBYNBQNED-YUMQZZPRSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | trans-(1S,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid |
| InChIKey | BUEPEVBYNBQNED-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCC[C@@H]1C(=O)O |
Computed by PubChem (NCBI)