CAS 130981-12-3 appears in our catalog under these names: (1R,2S)-2-((tert-Butoxycarbonyl)amino)cyclopentanecarboxylic acid, 98%, (1R,2S)-2-[(tert-Butoxycarbonyl)amino]cyclopentanecarboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 250mg.
Cis-(1R,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid (CAS 130981-12-3) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: cis-(1R,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid. InChIKey: BUEPEVBYNBQNED-SFYZADRCSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | cis-(1R,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid |
| InChIKey | BUEPEVBYNBQNED-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)