cas: 1391433-36-5 — see every product listed under this CAS number, including other names
(1S)-1-(2-Chloro-4-fluorophenyl)ethan-1-amine hydrochloride, 97% (CAS 1391433-36-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F695475-50MG |
| cas | 1391433-36-5 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 435.28 Pln | |
| Fluorochem | 100mg | 695.61 Pln | |
| Fluorochem | 250mg | 1127.75 Pln | |
| Fluorochem | 500mg | 1856.66 Pln | |
| Fluorochem | 1g | 2481.44 Pln | |
| Fluorochem | 2.5g | 6125.99 Pln | |
| Fluorochem | 5g | 9562.28 Pln | |
| Fluorochem | 10g | 19064.14 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(1S)-1-(2-chloro-4-fluorophenyl)ethanamine;hydrochloride (CAS 1391433-36-5) is a chemical compound with the molecular formula C8H10Cl2FN and a molecular weight of 210.07 g/mol. IUPAC name: (1S)-1-(2-chloro-4-fluorophenyl)ethanamine;hydrochloride. InChIKey: ADHMUZNAMAJFTD-JEDNCBNOSA-N.
| Molecular formula | C8H10Cl2FN |
|---|---|
| Molecular weight | 210.07 g/mol |
| IUPAC name | (1S)-1-(2-chloro-4-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | ADHMUZNAMAJFTD-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=C(C=C(C=C1)F)Cl)N.Cl |
Computed by PubChem (NCBI)