CAS 1313593-59-7 appears in our catalog under these names: (S)-1-(3-Chloro-2-fluorophenyl)ethanamine hydrochloride, 95%, (S)-1-(3-Chloro-2-fluorophenyl)ethanamine hydrochloride, 97%, 97%, (S)-1-(3-Chloro-2-fluorophenyl)ethanamine hydrochloride, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 50mg.
(1S)-1-(3-chloro-2-fluorophenyl)ethanamine;hydrochloride (CAS 1313593-59-7) is a chemical compound with the molecular formula C8H10Cl2FN and a molecular weight of 210.07 g/mol. IUPAC name: (1S)-1-(3-chloro-2-fluorophenyl)ethanamine;hydrochloride. InChIKey: CEVBNFPEJNNLJJ-JEDNCBNOSA-N.
| Molecular formula | C8H10Cl2FN |
|---|---|
| Molecular weight | 210.07 g/mol |
| IUPAC name | (1S)-1-(3-chloro-2-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | CEVBNFPEJNNLJJ-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=C(C(=CC=C1)Cl)F)N.Cl |
Computed by PubChem (NCBI)