cas: 906528-67-4 — see every product listed under this CAS number, including other names
(1S)-1-(3,4-Dimethoxyphenyl)ethan-1-amine hydrochloride 95% (CAS 906528-67-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1066125-250mg |
| cas | 906528-67-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1694.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1066125 |
(1S)-1-(3,4-dimethoxyphenyl)ethanamine;hydrochloride (CAS 906528-67-4) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 217.69 g/mol. IUPAC name: (1S)-1-(3,4-dimethoxyphenyl)ethanamine;hydrochloride. InChIKey: PQHFDOBOSKIMTO-FJXQXJEOSA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | (1S)-1-(3,4-dimethoxyphenyl)ethanamine;hydrochloride |
| InChIKey | PQHFDOBOSKIMTO-FJXQXJEOSA-N |
| SMILES | C[C@@H](C1=CC(=C(C=C1)OC)OC)N.Cl |
Computed by PubChem (NCBI)