CAS 906528-67-4 appears in our catalog under these names: (1S)-1-(3,4-Dimethoxyphenyl)ethan-1-amine hydrochloride, 95%, (1S)-1-(3,4-Dimethoxyphenyl)ethan-1-amine hydrochloride, (1S)-1-(3,4-Dimethoxyphenyl)ethan-1-amine hydrochloride 95%, (1S)-1-(3,4-Dimethoxyphenyl)ethan-1-amine hydrochloride, 95%, 95%, (1S)-1-(3,4-Dimethoxyphenyl)ethan-1-amine hydrochloride, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 2,5g, 5g.
(1S)-1-(3,4-dimethoxyphenyl)ethanamine;hydrochloride (CAS 906528-67-4) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 217.69 g/mol. IUPAC name: (1S)-1-(3,4-dimethoxyphenyl)ethanamine;hydrochloride. InChIKey: PQHFDOBOSKIMTO-FJXQXJEOSA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | (1S)-1-(3,4-dimethoxyphenyl)ethanamine;hydrochloride |
| InChIKey | PQHFDOBOSKIMTO-FJXQXJEOSA-N |
| SMILES | C[C@@H](C1=CC(=C(C=C1)OC)OC)N.Cl |
Computed by PubChem (NCBI)