CAS 137170-89-9 appears in our catalog under these names: (1S,2R)-2-(Boc-amino)cyclopentanecarboxylic acid, 95%, (1S,2R)–2–(Boc–amino)cyclopentanecarboxylic Acid, (1S,2R)-2-(Boc-amino)cyclopentanecarboxylic Acid, 97%, 97%, (1S,2R)-2-((tert-Butoxycarbonyl)amino)cyclopentanecarboxylic acid, 96%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 250mg, 100mg, 10g.
Cis-(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid (CAS 137170-89-9) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: cis-(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid. InChIKey: BUEPEVBYNBQNED-JGVFFNPUSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | cis-(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid |
| InChIKey | BUEPEVBYNBQNED-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@@H]1C(=O)O |
Computed by PubChem (NCBI)