CAS 907606-68-2 is the registry number for (1S,3aR,6aS)-tert-Butyl octahydrocyclopenta[c]pyrrole-1-carboxylate oxalate, 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
Tert-butyl (3S,3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxylate;oxalic acid (CAS 907606-68-2) is a chemical compound with the molecular formula C14H23NO6 and a molecular weight of 301.34 g/mol. IUPAC name: tert-butyl (3S,3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxylate;oxalic acid. InChIKey: ZCTXDLWZMFBZEV-PUBMXKGKSA-N.
| Molecular formula | C14H23NO6 |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | tert-butyl (3S,3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxylate;oxalic acid |
| InChIKey | ZCTXDLWZMFBZEV-PUBMXKGKSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1[C@H]2CCC[C@H]2CN1.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)