cas: 72768-97-9 — see every product listed under this CAS number, including other names
(2,2-Difluorobenzo[d][1,3]dioxol-5-yl)methanol, 98% (CAS 72768-97-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F218466-1G |
| cas | 72768-97-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 529.00 Pln | |
| Fluorochem | 10g | 669.57 Pln | |
| Fluorochem | 25g | 1565.09 Pln | |
| Fluorochem | 100g | 6073.92 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2,2-difluoro-1,3-benzodioxol-5-yl)methanol (CAS 72768-97-9) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: (2,2-difluoro-1,3-benzodioxol-5-yl)methanol. InChIKey: PJPDSEYHEHGLOH-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | (2,2-difluoro-1,3-benzodioxol-5-yl)methanol |
| InChIKey | PJPDSEYHEHGLOH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CO)OC(O2)(F)F |
Computed by PubChem (NCBI)