CAS 480438-97-9 is the registry number for 4,4-Difluoro-1-(furan-2-yl)butane-1,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4,4-difluoro-1-(furan-2-yl)butane-1,3-dione (CAS 480438-97-9) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: 4,4-difluoro-1-(furan-2-yl)butane-1,3-dione. InChIKey: RBNCWOLHQIFKHV-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 4,4-difluoro-1-(furan-2-yl)butane-1,3-dione |
| InChIKey | RBNCWOLHQIFKHV-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(=O)CC(=O)C(F)F |
Computed by PubChem (NCBI)