Products 887584-98-7
CAS 887584-98-7 appears in our catalog under these names: 3,4-Difluoro-5-methoxybenzoic acid, 98%, 3,4-difluoro-5-methoxybenzoic acid, 95%, 3，4–Difluoro–5–methoxybenzoic acid, 3,4-Difluoro-5-methoxybenzoic acid, 3,4-Difluoro-5-methoxybenzoic acid 97%. Offered by: Fluorochem, Combi-blocks, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg, 2,5g.
3,4-difluoro-5-methoxybenzoic acid (CAS 887584-98-7) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: 3,4-difluoro-5-methoxybenzoic acid. InChIKey: ABWUPGYAHCQXHK-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 3,4-difluoro-5-methoxybenzoic acid |
| InChIKey | ABWUPGYAHCQXHK-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C(=O)O)F)F |
Computed by PubChem (NCBI)