CAS 194804-80-3 appears in our catalog under these names: Methyl 2,4-difluoro-3-hydroxybenzoate, 95%, 2,4-Difluoro-3-hydroxybenzoic acid methyl ester, 2,4-difluoro-3-hydroxybenzoic acid methyl ester, 95%, 95%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 1000mg, 500mg, 2000mg, 5000mg, 100mg.
Methyl 2,4-difluoro-3-hydroxybenzoate (CAS 194804-80-3) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: methyl 2,4-difluoro-3-hydroxybenzoate. InChIKey: IASILBBAKSGQJC-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | methyl 2,4-difluoro-3-hydroxybenzoate |
| InChIKey | IASILBBAKSGQJC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)F)O)F |
Computed by PubChem (NCBI)