Products 178974-97-5
CAS 178974-97-5 appears in our catalog under these names: 2,4-Difluoro-3-methoxybenzoic acid, 98%, 2,4–Difluoro–3–methoxybenzoic Acid, 2,4-Difluoro-3-methoxybenzoic acid, 98+% , 2,4-Difluoro-3-methoxybenzoic Acid, >98.0%(GC)(T), 2,4-Difluoro-3-methoxybenzoic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 25g, 5g, 100g, 1g, 100mg, 250mg.
2,4-difluoro-3-methoxybenzoic acid (CAS 178974-97-5) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: 2,4-difluoro-3-methoxybenzoic acid. InChIKey: KWLIGHXPUYUTBH-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 2,4-difluoro-3-methoxybenzoic acid |
| InChIKey | KWLIGHXPUYUTBH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1F)C(=O)O)F |
Computed by PubChem (NCBI)