CAS 72768-97-9 appears in our catalog under these names: (2,2-Difluoro-benzo[1,3]dioxol-5-yl)-methanol, 96%, (2,2-Difluorobenzo[d][1,3]dioxol-5-yl)methanol, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 100g, 5g, 25g, 1g.
(2,2-difluoro-1,3-benzodioxol-5-yl)methanol (CAS 72768-97-9) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: (2,2-difluoro-1,3-benzodioxol-5-yl)methanol. InChIKey: PJPDSEYHEHGLOH-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | (2,2-difluoro-1,3-benzodioxol-5-yl)methanol |
| InChIKey | PJPDSEYHEHGLOH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CO)OC(O2)(F)F |
Computed by PubChem (NCBI)