CAS 887267-03-0 appears in our catalog under these names: 3,6-Difluoro-2-methoxybenzoic acid, 95%, 3,6-Difluoro-2-methoxybenzoic acid, 98%, 3,6-Difluoro-2-methoxybenzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg.
3,6-difluoro-2-methoxybenzoic acid (CAS 887267-03-0) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: 3,6-difluoro-2-methoxybenzoic acid. InChIKey: LFXJCALGZMNDHA-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 3,6-difluoro-2-methoxybenzoic acid |
| InChIKey | LFXJCALGZMNDHA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1C(=O)O)F)F |
Computed by PubChem (NCBI)