cas: 1028748-08-4 — see every product listed under this CAS number, including other names
(2,2-Dimethyl-2,3-dihydro-1-benzofuran-5-yl)boronic acid, 95%, 95% (CAS 1028748-08-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12AJ4C-50mg |
| cas | 1028748-08-4 |
| size | 50mg |
| availability | 20g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 386.00 Pln | |
| Chemat | 100mg | 602.00 Pln | |
| Chemat | 250mg | 962.00 Pln | |
| Chemat | 500mg | 1418.00 Pln | |
| Chemat | 1g | 1893.20 Pln | |
| Chemat | 2.5g | 3400.40 Pln | |
| Chemat | 5g | 5378.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2,2-dimethyl-3H-1-benzofuran-5-yl)boronic acid (CAS 1028748-08-4) is a chemical compound with the molecular formula C10H13BO3 and a molecular weight of 192.02 g/mol. IUPAC name: (2,2-dimethyl-3H-1-benzofuran-5-yl)boronic acid. InChIKey: APZZJRJOSLSLLR-UHFFFAOYSA-N.
| Molecular formula | C10H13BO3 |
|---|---|
| Molecular weight | 192.02 g/mol |
| IUPAC name | (2,2-dimethyl-3H-1-benzofuran-5-yl)boronic acid |
| InChIKey | APZZJRJOSLSLLR-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OC(C2)(C)C)(O)O |
Computed by PubChem (NCBI)