CAS 1028748-08-4 appears in our catalog under these names: (2,2-Dimethyl-2,3-dihydro-1-benzofuran-5-yl)boronic acid, 95%, (2,2-Dimethyl-2,3-dihydro-1-benzofuran-5-yl)boronic acid, 95%, 95%, (2,2-Dimethyl-2,3-dihydrobenzofuran-5-yl)boronic acid, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 100mg, 250mg, 500mg, 1g, 2.5g.
(2,2-dimethyl-3H-1-benzofuran-5-yl)boronic acid (CAS 1028748-08-4) is a chemical compound with the molecular formula C10H13BO3 and a molecular weight of 192.02 g/mol. IUPAC name: (2,2-dimethyl-3H-1-benzofuran-5-yl)boronic acid. InChIKey: APZZJRJOSLSLLR-UHFFFAOYSA-N.
| Molecular formula | C10H13BO3 |
|---|---|
| Molecular weight | 192.02 g/mol |
| IUPAC name | (2,2-dimethyl-3H-1-benzofuran-5-yl)boronic acid |
| InChIKey | APZZJRJOSLSLLR-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OC(C2)(C)C)(O)O |
Computed by PubChem (NCBI)