cas: 871125-70-1 — see every product listed under this CAS number, including other names
(2,4,6-Trifluoro-3-propoxyphenyl)boronic acid, 95% (CAS 871125-70-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A881689-5g |
| cas | 871125-70-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 4294.99 Pln | |
| AmBeed | 250mg | 1000.93 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2,4,6-trifluoro-3-propoxyphenyl)boronic acid (CAS 871125-70-1) is a chemical compound with the molecular formula C9H10BF3O3 and a molecular weight of 233.98 g/mol. IUPAC name: (2,4,6-trifluoro-3-propoxyphenyl)boronic acid. InChIKey: FRGFAHSCPSYBHI-UHFFFAOYSA-N.
| Molecular formula | C9H10BF3O3 |
|---|---|
| Molecular weight | 233.98 g/mol |
| IUPAC name | (2,4,6-trifluoro-3-propoxyphenyl)boronic acid |
| InChIKey | FRGFAHSCPSYBHI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1F)F)OCCC)F)(O)O |
Computed by PubChem (NCBI)