CAS 871329-83-8 appears in our catalog under these names: (4-Ethoxy-3-trifluoromethylphenyl)boronic acid, 95-<97%, (4-Ethoxy-3-trifluoromethylphenyl)boronic acid, ≥97-<99%, 4-Ethoxy-3-(trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride), B-[4-Ethoxy-3-(trifluoromethyl)phenyl]boronic acid, 98%, 98%, 4-Ethoxy-3-(trifluoromethyl)phenylboronic acid, 98%. Offered by: Hoffman Fine Chemicals, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 200mg, 1g.
[4-ethoxy-3-(trifluoromethyl)phenyl]boronic acid (CAS 871329-83-8) is a chemical compound with the molecular formula C9H10BF3O3 and a molecular weight of 233.98 g/mol. IUPAC name: [4-ethoxy-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: SHCPXHBLEGXHIV-UHFFFAOYSA-N.
| Molecular formula | C9H10BF3O3 |
|---|---|
| Molecular weight | 233.98 g/mol |
| IUPAC name | [4-ethoxy-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | SHCPXHBLEGXHIV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCC)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)