CAS 1334218-47-1 appears in our catalog under these names: (3–((2,2,2–Trifluoroethoxy)methyl)phenyl)boronic acid, 3-[(2,2,2-Trifluoroethoxy)methyl]phenylboronic acid, 98+%, 98+%, (3-((2,2,2-Trifluoroethoxy)methyl)phenyl)boronic acid, 98+%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
[3-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid (CAS 1334218-47-1) is a chemical compound with the molecular formula C9H10BF3O3 and a molecular weight of 233.98 g/mol. IUPAC name: [3-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid. InChIKey: CMSCGNHIQQEFFO-UHFFFAOYSA-N.
| Molecular formula | C9H10BF3O3 |
|---|---|
| Molecular weight | 233.98 g/mol |
| IUPAC name | [3-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid |
| InChIKey | CMSCGNHIQQEFFO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)COCC(F)(F)F)(O)O |
Computed by PubChem (NCBI)