(2,4-Difluoro-3-(methoxycarbonyl)phenyl)boronic acid, 98%
cas: 1190989-12-8 — see every product listed under this CAS number, including other names
(2,4-Difluoro-3-(methoxycarbonyl)phenyl)boronic acid, 98% (CAS 1190989-12-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F694284-250MG |
| cas | 1190989-12-8 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 638.33 Pln | |
| Fluorochem | 5g | 1872.28 Pln | |
| Fluorochem | 10g | 3278.03 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 642.94 Pln | |
| Ambeed | 5g | 1844.44 Pln | |
| Ambeed | 25g | 6739.44 Pln | |
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 506.00 Pln | |
| Chemat | 5g | 1461.20 Pln | |
| BLDpharm | 100mg | 269.93 Pln | |
| BLDpharm | 250mg | 314.36 Pln | |
| BLDpharm | 1g | 686.45 Pln | |
| BLDpharm | 5g | 1980.44 Pln | |
| BLDpharm | 25g | 7261.91 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2,4-difluoro-3-methoxycarbonylphenyl)boronic acid (CAS 1190989-12-8) is a chemical compound with the molecular formula C8H7BF2O4 and a molecular weight of 215.95 g/mol. IUPAC name: (2,4-difluoro-3-methoxycarbonylphenyl)boronic acid. InChIKey: DAXRETVCZVZSNS-UHFFFAOYSA-N.
| Molecular formula | C8H7BF2O4 |
|---|---|
| Molecular weight | 215.95 g/mol |
| IUPAC name | (2,4-difluoro-3-methoxycarbonylphenyl)boronic acid |
| InChIKey | DAXRETVCZVZSNS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)C(=O)OC)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2,4-Difluoro-3-(methoxycarbonyl)phenyl)boronic acid, 2,4-Difluoro-3-methoxycarbonylphenylboronic acid, (2,4-difluoro-3-methoxycarbonylphenyl)boronic acid, Benzoic acid, 3-borono-2,6-difluoro-, 1-methyl ester, (2,4-Difluoro-3-methoxycarbonyl-phenyl)boronic acid, [2,4-Difluoro-3-(methoxycarbonyl)phenyl]boronic acid, (2,4-Difluoro-3-(methoxycarbonyl)phenyl)boronicacid, (2,4-Difluoro-3-(methoxycarbonyl)phenyl)boronic acid - [D88724]