CAS 2096334-34-6 appears in our catalog under these names: 4,5-Difluoro-2-(methoxycarbonyl)phenylboronic acid, 98%, (4,5-Difluoro-2-(methoxycarbonyl)phenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(4,5-difluoro-2-methoxycarbonylphenyl)boronic acid (CAS 2096334-34-6) is a chemical compound with the molecular formula C8H7BF2O4 and a molecular weight of 215.95 g/mol. IUPAC name: (4,5-difluoro-2-methoxycarbonylphenyl)boronic acid. InChIKey: FKBKLXXNCMSJMQ-UHFFFAOYSA-N.
| Molecular formula | C8H7BF2O4 |
|---|---|
| Molecular weight | 215.95 g/mol |
| IUPAC name | (4,5-difluoro-2-methoxycarbonylphenyl)boronic acid |
| InChIKey | FKBKLXXNCMSJMQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C(=O)OC)F)F)(O)O |
Computed by PubChem (NCBI)