CAS 1190989-09-3 appears in our catalog under these names: 3,5-Difluoro-4-(methoxycarbonyl)phenylboronic acid, 96%, 3,5–Difluoro–4–(methoxycarbonyl)phenylboronic acid, (3,5-Difluoro-4-(methoxycarbonyl)phenyl)boronic acid 98%, (3,5-Difluoro-4-(Methoxycarbonyl)Phenyl)Boronic Acid, 98%, 98%, (3,5-Difluoro-4-(methoxycarbonyl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg, 500mg, 100mg, 25g, 100g.
(3,5-difluoro-4-methoxycarbonylphenyl)boronic acid (CAS 1190989-09-3) is a chemical compound with the molecular formula C8H7BF2O4 and a molecular weight of 215.95 g/mol. IUPAC name: (3,5-difluoro-4-methoxycarbonylphenyl)boronic acid. InChIKey: DFSQCSAZKURRRE-UHFFFAOYSA-N.
| Molecular formula | C8H7BF2O4 |
|---|---|
| Molecular weight | 215.95 g/mol |
| IUPAC name | (3,5-difluoro-4-methoxycarbonylphenyl)boronic acid |
| InChIKey | DFSQCSAZKURRRE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)C(=O)OC)F)(O)O |
Computed by PubChem (NCBI)