CAS 1190989-12-8 appears in our catalog under these names: 2,4-Difluoro-3-(methoxycarbonyl)phenylboronic acid, 96%, 2,4–Difluoro–3–(methoxycarbonyl)phenylboronic acid, (2,4-Difluoro-3-(methoxycarbonyl)phenyl)boronic acid 98%, (2,4-Difluoro-3-(Methoxycarbonyl)Phenyl)Boronic Acid, 98%, 98%, (2,4-Difluoro-3-(methoxycarbonyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 500mg, 100mg, 25g.
(2,4-difluoro-3-methoxycarbonylphenyl)boronic acid (CAS 1190989-12-8) is a chemical compound with the molecular formula C8H7BF2O4 and a molecular weight of 215.95 g/mol. IUPAC name: (2,4-difluoro-3-methoxycarbonylphenyl)boronic acid. InChIKey: DAXRETVCZVZSNS-UHFFFAOYSA-N.
| Molecular formula | C8H7BF2O4 |
|---|---|
| Molecular weight | 215.95 g/mol |
| IUPAC name | (2,4-difluoro-3-methoxycarbonylphenyl)boronic acid |
| InChIKey | DAXRETVCZVZSNS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)C(=O)OC)F)(O)O |
Computed by PubChem (NCBI)