Products 2022984-58-1
CAS 2022984-58-1 appears in our catalog under these names: 4-Methoxycarbonyl-2,6-difluorophenylboronic acid, 96%, 4-Methoxycarbonyl-2,6-difluorophenylboronic acid 96%, 4-Methoxycarbonyl-2,6-difluorophenylboronic acid, 97%, 97%, 4-Methoxycarbonyl-2,6-difluorophenylboronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
(2,6-difluoro-4-methoxycarbonylphenyl)boronic acid (CAS 2022984-58-1) is a chemical compound with the molecular formula C8H7BF2O4 and a molecular weight of 215.95 g/mol. IUPAC name: (2,6-difluoro-4-methoxycarbonylphenyl)boronic acid. InChIKey: UAQVWIOVTATRBS-UHFFFAOYSA-N.
| Molecular formula | C8H7BF2O4 |
|---|---|
| Molecular weight | 215.95 g/mol |
| IUPAC name | (2,6-difluoro-4-methoxycarbonylphenyl)boronic acid |
| InChIKey | UAQVWIOVTATRBS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)C(=O)OC)F)(O)O |
Computed by PubChem (NCBI)